lalisa1186 lalisa1186

03-02-2021
English

contestada

Gow often you study your lesson in english?(seldom)

Respuesta :

jrjenhdhdheh jrjenhdhdheh

03-02-2021

2 hours a day I think or sometimes an hour is enough

Answer Link

Otras preguntas

Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl

Under the NASAA model custody rule, an investment adviser would be considered to have custody of client assets if that adviser inadvertently receives: i. a chec

12. What group of organisms are most in danger of extinction? those with small populations both a and b those with large populations that breed quickly those th

Helppppp thxxxxxxxxxx

Liam tried to define a translation. - Point A maps to point A' - Every point P maps to point P' such that PP' is parallel to AA' and points in the same directio

A weather balloon holds 2,600 cubic meters of helium. The density of helium is 0.1755 kilograms per cubic meter. How many kilograms of helium does the balloon c

The pair of figures is similar. Find x. Round to the nearest tenth if necessary.

what is the SI unit of focal length,

please help question attached

2. Why has the tense relationship between India and Pakistan raised global concern?