connorbenton8 connorbenton8
  • 03-03-2021
  • Mathematics
contestada

Q8. Divide £60.50 in the ratio 8 : 3

Respuesta :

hamza48 hamza48
  • 03-03-2021
How many times does £60.50 go in to 8 and how many times it goes into 3
The write the ratio with the answer for example 0:0
Answer Link

Otras preguntas

Which shows 42^2 − 38^2 being evaluated using the difference of perfect squares method? A) 42^2 − 38^2 = (1,764 − 1,444)(1,764 + 1,444) = 1,026,560 B) 42^2 −
On Novermber 30, in Paris,France, Americans signed a preliminary treaty with great britain
During a chemical change, substances react to form a new substance. Some signs of chemical change are gas formation, a change in color, or the production of hea
How do you do absolute value word problems
Determine whether the pair of lines is parallel,perpendicular or neither y=3x+2 , y=-3x-1
the form of energy stored in the bonds between atoms is
Hon placed aquatic plants in several test tubes that were filled with water. Then, he placed half of the test tubes in a dark closet and the other half in a wel
cosec(6b+pi/8)=sec(2b-pi/8)​
Does the sentence state a fact or an opinion? People should wait until they are at least eighteen before learning to drive.
Why do people of different religion in India eat different kinds of foods.