rolidymariPriski rolidymariPriski
  • 02-12-2016
  • Mathematics
contestada

What is 70/315 in simplest form?

Respuesta :

AryaVega
AryaVega AryaVega
  • 02-12-2016
You need to  find the greatest common factor which in this case is 5
Divide top and bottom by 5
You get:
14/63
Answer Link

Otras preguntas

What is the capital of North Carolina?
Massachusetts bay colony was a theocracy true or false
Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)
What economic system did some americans blame for the great depression?
Which of the following is a solution of x - 6 < 6 AND x + 4 ≥ -1?a. -2b. 12c. -8d. -9
Watch of the following statement contains a metaphor
How does melting point compare among molecular compounds and ionic compounds?
The sum of 3 numbers is 73, the first number is 5 less than the second, the third is 2 times more than the first, what are the three numbers
What effect did the iconoclast controversy have?
How did “the Magna Carta” lead to the English bill of rights?